CAS 1182705-22-1

3-(1-Methylethyl)-5-[[(phenylsulfonyl)oxy]methyl]-2-oxazolidinone

Description:

3-(1-Methylethyl)-5-[[(phenylsulfonyl)oxy]methyl]-2-oxazolidinone, with the CAS number 1182705-22-1, is a chemical compound characterized by its oxazolidinone structure, which is a five-membered heterocyclic ring containing both oxygen and nitrogen atoms. This compound features a branched alkyl group (isopropyl) at one position and a phenylsulfonyl group at another, indicating potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the sulfonyl group suggests that it may exhibit unique reactivity and solubility properties, which can influence its biological activity. Additionally, the oxazolidinone framework is known for its role in antibiotic development, particularly in the class of drugs known as oxazolidinones, which are used to treat bacterial infections. The compound's specific characteristics, such as melting point, solubility, and stability, would depend on its molecular interactions and the presence of functional groups, making it a subject of interest for further research in organic synthesis and drug design.

Formula: C₁₃H₁₇NO₅S

InChI: InChI=1S/C13H17NO5S/c1-10(2)14-8-11(19-13(14)15)9-18-20(16,17)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3

InChI key: InChIKey=JBNJFGXFRBWXRV-UHFFFAOYSA-N

SMILES: S(OCC1CN(C(C)C)C(=O)O1)(=O)(=O)C2=CC=CC=C2

Synonyms:

• 3-(1-Methylethyl)-5-[[(phenylsulfonyl)oxy]methyl]-2-oxazolidinone
• 2-Oxazolidinone, 3-(1-methylethyl)-5-[[(phenylsulfonyl)oxy]methyl]-

(3-Isopropyl-2-oxooxazolidin-5-yl)methyl benzenesulfonate

CAS: 1182705-22-1

Formula: C₁₃H₁₇NO₅S

Molecular weight: 299.34

Ref: ST-EA-CP-B14095