
CAS 1182722-58-2
:(3R)-3-Amino-1,2,3,4-tetrahydro-9H-carbazole-9-propanoic acid
Description:
(3R)-3-Amino-1,2,3,4-tetrahydro-9H-carbazole-9-propanoic acid, with the CAS number 1182722-58-2, is a chemical compound characterized by its unique bicyclic structure, which includes a carbazole moiety. This compound features an amino group and a propanoic acid side chain, contributing to its potential biological activity. The presence of the tetrahydro configuration indicates that it is a saturated derivative of carbazole, which may influence its solubility and reactivity. The stereochemistry at the 3-position is significant, as it can affect the compound's interaction with biological targets, such as receptors or enzymes. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could lead to various therapeutic applications. Additionally, its properties, such as melting point, solubility, and stability, would be essential for understanding its behavior in biological systems and potential uses in drug development. Further studies would be necessary to elucidate its specific mechanisms of action and efficacy in relevant biological contexts.
Formula:C15H18N2O2
InChI:InChI=1S/C15H18N2O2/c16-10-5-6-14-12(9-10)11-3-1-2-4-13(11)17(14)8-7-15(18)19/h1-4,10H,5-9,16H2,(H,18,19)/t10-/m1/s1
InChI key:InChIKey=RRWZRHNYCZSEBR-SNVBAGLBSA-N
SMILES:C(CC(O)=O)N1C2=C(C=3C1=CC=CC3)C[C@H](N)CC2
Synonyms:- 9H-Carbazole-9-propanoic acid, 3-amino-1,2,3,4-tetrahydro-, (3R)-
- (3R)-3-Amino-1,2,3,4-tetrahydro-9H-carbazole-9-propanoic acid
- 3-[(3R)-3-Amino-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.