CAS 1182728-22-8

4-[2-Chloro-3-[(phenylmethyl)thio]phenyl]-3-morpholinone

Description:

4-[2-Chloro-3-[(phenylmethyl)thio]phenyl]-3-morpholinone is a synthetic organic compound characterized by its complex structure, which includes a morpholinone ring and a chlorophenyl moiety. The presence of a chlorine atom and a phenylmethylthio group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents. The morpholinone ring is known for its role in various bioactive compounds, often enhancing solubility and stability. Additionally, the compound's characteristics, such as solubility, melting point, and stability, would depend on the specific conditions under which it is studied. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further research would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₇H₁₆ClNO₂S

InChI: InChI=1S/C17H16ClNO2S/c18-17-14(19-9-10-21-11-16(19)20)7-4-8-15(17)22-12-13-5-2-1-3-6-13/h1-8H,9-12H2

InChI key: InChIKey=OIAYKCLSOVNICQ-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC=C1SCC2=CC=CC=C2)N3C(=O)COCC3

Synonyms:

• 4-[2-Chloro-3-[(phenylmethyl)thio]phenyl]-3-morpholinone
• 3-Morpholinone, 4-[2-chloro-3-[(phenylmethyl)thio]phenyl]-
• 4-(3-Benzylsulfanyl-2-chlorophenyl)morpholin-3-one