CAS 118289-97-7
:(2S)-2-[4-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)phenyl]butanoic acid
Description:
The chemical substance known as (2S)-2-[4-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)phenyl]butanoic acid, with the CAS number 118289-97-7, is a compound that features a butanoic acid backbone with a chiral center at the second carbon. This compound contains a phenyl group substituted with an isoindole moiety, which contributes to its structural complexity and potential biological activity. The presence of the carbonyl group in the isoindole structure suggests that it may participate in various chemical reactions, including those involving nucleophiles. The stereochemistry indicated by the (2S) designation implies that the compound has specific spatial arrangements that can influence its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's acidic functional group (carboxylic acid) may affect its solubility and reactivity in different environments. Overall, this substance may have applications in pharmaceuticals or as a research chemical, particularly in studies related to its biological effects or synthetic utility.
Formula:C18H17NO3
InChI:InChI=1/C18H17NO3/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20/h3-10,15H,2,11H2,1H3,(H,21,22)/t15-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

