CAS 118291-90-0
:2-chloro-4-nitrophenylmaltotrioside
Description:
2-Chloro-4-nitrophenylmaltotrioside is a synthetic compound that belongs to the class of glycosides, specifically a maltotrioside derivative. It features a maltotrioside moiety, which is a carbohydrate composed of three glucose units linked together, and is modified by the presence of a 2-chloro-4-nitrophenyl group. This substitution introduces both a chlorine atom and a nitro group, which can influence the compound's reactivity and solubility. The presence of the nitro group typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including those involving nucleophiles. This compound is often utilized in biochemical research, particularly in studies related to enzyme activity, as it can serve as a substrate for glycoside hydrolases. Its unique structural features may also impart specific biological activities, making it of interest in pharmacological studies. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C24H34ClNO18
InChI:InChI=1/C24H34ClNO18/c25-9-3-7(26(38)39)1-2-8(9)24(44-23-20(37)17(34)14(31)11(5-28)41-23)21(18(35)15(32)12(6-29)43-24)42-22-19(36)16(33)13(30)10(4-27)40-22/h1-3,10-23,27-37H,4-6H2/t10-,11-,12-,13-,14-,15-,16+,17+,18+,19-,20-,21-,22-,23-,24-/m1/s1
Synonyms:- 2-Chloro-4-nitrophenyl-α-D-maltotrioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Chloro-4-nitrophenyl a-D-maltotrioside
CAS:Formula:C24H34ClNO18Purity:99%Color and Shape:SolidMolecular weight:659.9757G3-CNP
CAS:<p>G3-CNP is a substrate for α-amylase and the hydrolysis product is 2-chloro-4-nitrophenol, enzyme activity by colorimetric assay at 405 nm.</p>Formula:C24H34ClNO18Color and Shape:SolidMolecular weight:659.982-Chloro-4-nitrophenyl a-D-maltotrioside
CAS:Formula:C24H34ClNO18Purity:(HPLC) ≥ 95.0%Color and Shape:Off-white to pale yellow powderMolecular weight:659.982-Chloro-4-nitrophenyl α-D-maltotrioside
CAS:2-Chloro-4-nitrophenyl α-D-maltotriosideFormula:C24H34ClNO18Purity:99%Color and Shape: white solidMolecular weight:659.98g/mol2-Chloro-4-nitrophenyl α-D-Maltotrioside
CAS:Formula:C24H34ClNO18Color and Shape:Off-White To Light YellowMolecular weight:659.982-Chloro-4-nitrophenyl a-D-maltotrioside
CAS:<p>2-Chloro-4-nitrophenyl a-D-maltotrioside (2CNP) is a potent hypoglycemic agent that has been shown to decrease postprandial blood glucose levels in humans. 2CNP is a white crystalline solid that is soluble in water and ethanol. The transfer reactions of 2CNP are enhanced by benzalkonium chloride, which forms an organic complex with the drug. The optimum concentration for the hypoglycemic effect of 2CNP is determined to be 10 μM, which can be detected using an optical sensor. This compound also inhibits α-amylase and other enzymes involved in carbohydrate metabolism, leading to the accumulation of glycogen and lowering the blood glucose level.</p>Formula:C24H34CiNO18Purity:Min. 95%Color and Shape:Off-White Yellow PowderMolecular weight:659.98 g/mol2-Chloro-4-Nitrophenyl a-D-Maltotrioside (CNPG3) extrapure, 95%
CAS:Formula:C24H34ClNO18Purity:min. 95%Color and Shape:Pale yellow, Crystalline compoundMolecular weight:659.98






