CymitQuimica logo

CAS 118313-87-4

:

2-bromo-3-fluoroaniline hydrochloride

Description:
2-Bromo-3-fluoroaniline hydrochloride is an organic compound characterized by the presence of both bromine and fluorine substituents on an aniline structure. It features a bromine atom at the second position and a fluorine atom at the third position of the aromatic ring, which significantly influences its chemical reactivity and properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications in organic synthesis and pharmaceutical research. This compound is typically used as an intermediate in the synthesis of more complex molecules, particularly in the development of agrochemicals and pharmaceuticals. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 2-bromo-3-fluoroaniline hydrochloride is a valuable compound in chemical research and development.
Formula:C6H6BrClFN
InChI:InChI=1/C6H5BrFN.ClH/c7-6-4(8)2-1-3-5(6)9;/h1-3H,9H2;1H
SMILES:c1cc(c(c(c1)N)Br)F.Cl
Synonyms:
  • 2-Brom-3-fluoranilinhydrochlorid
  • 2-Bromo-3-fluoroaniline chlorhydrate
  • Benzenamine, 2-Bromo-3-Fluoro-, Hydrochloride (1:1)
  • 2-Bromo-3-fluoroaniline hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.