
CAS 1183233-94-4
:2-(Methylthio)cyclopentanecarbonitrile
Description:
2-(Methylthio)cyclopentanecarbonitrile is an organic compound characterized by its unique structure, which includes a cyclopentane ring substituted with a methylthio group and a carbonitrile functional group. The presence of the methylthio group introduces sulfur into the molecule, which can influence its reactivity and physical properties, such as solubility and boiling point. The carbonitrile group, characterized by the presence of a cyano (-C≡N) functional group, contributes to the compound's polarity and can participate in various chemical reactions, including nucleophilic additions and cycloadditions. This compound may exhibit interesting biological activities due to its structural features, making it a potential candidate for further research in medicinal chemistry. Additionally, its synthesis typically involves multi-step organic reactions, which may include the formation of the cyclopentane ring and subsequent functionalization. Overall, 2-(Methylthio)cyclopentanecarbonitrile represents a class of compounds that can be explored for various applications in organic synthesis and pharmaceuticals.
Formula:C7H11NS
InChI:InChI=1S/C7H11NS/c1-9-7-4-2-3-6(7)5-8/h6-7H,2-4H2,1H3
InChI key:InChIKey=QPYGJORCDHTOBG-UHFFFAOYSA-N
SMILES:C(#N)C1C(SC)CCC1
Synonyms:- Cyclopentanecarbonitrile, 2-(methylthio)-
- 2-(Methylthio)cyclopentanecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.