CAS 118325-22-7

Licoricesaponin A3

Description:

Licoricesaponin A3 is a triterpenoid saponin derived from the root of Glycyrrhiza species, particularly Glycyrrhiza uralensis, commonly known as licorice. This compound is characterized by its complex structure, which includes a steroid-like aglycone and sugar moieties, contributing to its amphiphilic nature. Licoricesaponin A3 exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action often involves modulation of signaling pathways and interaction with cell membranes, which can influence cellular processes. Additionally, it has been studied for its effects on the immune system and its potential to enhance the bioavailability of other therapeutic agents. The compound is typically analyzed using techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry to determine its purity and concentration in various formulations. Overall, Licoricesaponin A3 represents a significant component of licorice with promising health benefits and applications in traditional and modern medicine.

Formula: C₄₈H₇₂O₂₁

InChI: InChI=1S/C48H72O21/c1-43(2)23-8-11-48(7)36(21(50)16-19-20-17-45(4,13-12-44(20,3)14-15-47(19,48)6)42(63)69-39-31(57)26(52)25(51)22(18-49)64-39)46(23,5)10-9-24(43)65-41-35(30(56)29(55)34(67-41)38(61)62)68-40-32(58)27(53)28(54)33(66-40)37(59)60/h16,20,22-36,39-41,49,51-58H,8-15,17-18H2,1-7H3,(H,59,60)(H,61,62)/t20-,22+,23-,24-,25+,26-,27-,28-,29-,30-,31+,32+,33-,34-,35+,36+,39-,40-,41+,44+,45-,46-,47+,48+/m0/s1

InChI key: InChIKey=HJFOOTRGDAPZMV-SMVKYPPISA-N

SMILES: C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O4)CC3)[H])(C(=O)C=C6[C@@]2(C)CC[C@]7(C)[C@]6(C[C@](C(O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)=O)(C)CC7)[H])[H]

Synonyms:

• β-D-Glucopyranosiduronic acid, (3β,20β)-29-(β-D-glucopyranosyloxy)-11,29-dioxoolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-
• Licoricesaponin A3
• (3β,20β)-29-(β-D-Glucopyranosyloxy)-11,29-dioxoolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-β-D-glucopyranosiduronic acid

Licoricesaponin A3

CAS: 118325-22-7

Licoricesaponin A3 is a terpenoid saponin extracted from Gymnostachyum febrifugum Benth., which has good affinity for 5-LOX receptors.

Formula: C₄₈H₇₂O₂₁

Purity: 98%

Color and Shape: Solid

Molecular weight: 985.07

Ref: TM-TN1865

Licoricesaponin A3

CAS: 118325-22-7

Licoricesaponin A3 is a triterpenoid saponin, a naturally occurring compound extracted from the roots of Glycyrrhiza glabra, commonly known as licorice. The plant is renowned for its medicinal properties, and Licoricesaponin A3 is one of the many bioactive components contributing to its therapeutic efficacy. This saponin exerts its action by modulating inflammatory pathways, inhibiting the production of pro-inflammatory cytokines, and attenuating oxidative stress. Due to these properties, Licoricesaponin A3 is under investigation for its potential benefits in managing inflammatory and autoimmune disorders. In addition, its role in cancer research is gaining attention as it may interfere with cancer cell survival pathways, offering a promising avenue for therapeutic development. The compound is typically employed in preclinical studies for drug discovery and the development of novel anti-inflammatory and anticancer therapies. As a phytochemical, Licoricesaponin A3 exemplifies the potential of plant-derived compounds in contributing to advanced medical research and therapeutic innovation.

Formula: C₄₈H₇₂O₂₁

Purity: Min. 95%

Molecular weight: 985.1 g/mol

Ref: 3D-TEA32522