CymitQuimica logo

CAS 118334-96-6

:

2,2,2-Trifluoro-1-(trifluoromethyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate

Description:
2,2,2-Trifluoro-1-(trifluoromethyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate, with CAS number 118334-96-6, is a fluorinated organic compound characterized by its complex structure featuring multiple fluorinated groups. This substance is a sulfonate ester, which typically enhances its solubility in polar solvents and contributes to its stability under various conditions. The presence of trifluoromethyl and nonafluorobutane moieties imparts unique properties, such as low surface tension and high thermal stability, making it useful in various applications, including as a surfactant or in specialty chemical formulations. Its fluorinated nature also suggests potential applications in fields like materials science and pharmaceuticals, where fluorinated compounds are often sought for their unique reactivity and stability. However, due to the environmental concerns associated with fluorinated compounds, particularly regarding their persistence and potential bioaccumulation, the use and disposal of such substances are subject to regulatory scrutiny. Overall, this compound exemplifies the intricate balance between utility and environmental impact in the realm of fluorinated chemicals.
Formula:C7HF15O3S
InChI:InChI=1S/C7HF15O3S/c8-2(9,10)1(3(11,12)13)25-26(23,24)7(21,22)5(16,17)4(14,15)6(18,19)20/h1H
InChI key:InChIKey=USGIGMPEVWTUKX-UHFFFAOYSA-N
SMILES:C(OS(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(=O)=O)(C(F)(F)F)C(F)(F)F
Synonyms:
  • 1-Butanesulfonic acid, 1,1,2,2,3,3,4,4,4-nonafluoro-, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester
  • 2,2,2-Trifluoro-1-(trifluoromethyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate
  • 1,1,1,3,3,3-Hexafluoropropan-2-yl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.