CAS 118384-65-9
:5-[(pyridin-3-ylmethyl)sulfanyl]-1,3,4-thiadiazol-2-amine
Description:
5-[(Pyridin-3-ylmethyl)sulfanyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a pyridine moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound contains a sulfanyl group, which can enhance its reactivity and interaction with biological targets. Additionally, the pyridine ring may influence the compound's solubility and lipophilicity, affecting its absorption and distribution in biological systems. This compound is of interest in medicinal chemistry and may be explored for its potential applications in drug development, particularly in the context of targeting specific enzymes or receptors. Its CAS number, 118384-65-9, serves as a unique identifier for regulatory and research purposes, facilitating the study and application of this compound in various scientific fields. Overall, the combination of its functional groups and ring structures suggests a diverse range of potential chemical behaviors and biological activities.
Formula:C8H8N4S2
InChI:InChI=1/C8H8N4S2/c9-7-11-12-8(14-7)13-5-6-2-1-3-10-4-6/h1-4H,5H2,(H2,9,11)
SMILES:c1cc(cnc1)CSc1n[nH]c(=N)s1
Synonyms:- 1,3,4-Thiadiazol-2-Amine, 5-[(3-Pyridinylmethyl)Thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
