CymitQuimica logo

CAS 1183845-87-5

:

1-[2-Fluoro-6-(4-methyl-1H-pyrazol-1-yl)phenyl]ethanone

Description:
1-[2-Fluoro-6-(4-methyl-1H-pyrazol-1-yl)phenyl]ethanone, with the CAS number 1183845-87-5, is an organic compound characterized by its complex structure, which includes a fluorinated phenyl group and a pyrazole moiety. The presence of the fluorine atom enhances its lipophilicity and can influence its biological activity. The ethanone functional group indicates that it is a ketone, which contributes to its reactivity and potential applications in organic synthesis. This compound may exhibit interesting pharmacological properties due to the presence of the pyrazole ring, which is often associated with various biological activities, including anti-inflammatory and analgesic effects. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and solubility characteristics would be important for its application in various chemical processes. Overall, 1-[2-Fluoro-6-(4-methyl-1H-pyrazol-1-yl)phenyl]ethanone represents a valuable compound for research in both synthetic and medicinal chemistry.
Formula:C12H11FN2O
InChI:InChI=1S/C12H11FN2O/c1-8-6-14-15(7-8)11-5-3-4-10(13)12(11)9(2)16/h3-7H,1-2H3
InChI key:InChIKey=ZXDMOORCQXFXPV-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(C=CC=C1F)N2C=C(C)C=N2
Synonyms:
  • Ethanone, 1-[2-fluoro-6-(4-methyl-1H-pyrazol-1-yl)phenyl]-
  • 1-[2-Fluoro-6-(4-methyl-1H-pyrazol-1-yl)phenyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.