CAS 118399-86-3

6-Bromo-3-hydroxy-2-methylpyridine

Description:

6-Bromo-3-hydroxy-2-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position and a hydroxyl group at the 3-position, along with a methyl group at the 2-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its structure suggests potential reactivity in electrophilic substitution reactions, particularly due to the electron-withdrawing effects of the bromine atom. Additionally, the hydroxyl group can participate in various chemical transformations, making it a versatile intermediate in organic synthesis. The compound may also exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₆H₆BrNO

InChI: InChI=1/C6H6BrNO/c1-4-5(9)2-3-6(7)8-4/h2-3,9H,1H3

SMILES: Cc1c(ccc(Br)n1)O

Synonyms:

• 3-Pyridinol, 6-Bromo-2-Methyl-
• 6-Bromo-2-methylpyridin-3-ol

6-Bromo-3-hydroxy-2-methylpyridine

CAS: 118399-86-3

Formula: C₆H₆BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0219

Ref: IN-DA008XTG

6-Bromo-2-methylpyridin-3-ol

CAS: 118399-86-3

6-Bromo-2-methylpyridin-3-ol

Purity: 97%

Molecular weight: 188.02g/mol

Ref: 54-OR941712

6-Bromo-2-methylpyridin-3-ol

CAS: 118399-86-3

Formula: C₆H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.024

Ref: 10-F223268