CAS 118409-60-2
:tyrphostin 47
Description:
Tyrphostin 47, identified by its CAS number 118409-60-2, is a synthetic compound that functions primarily as a selective inhibitor of receptor tyrosine kinases, particularly the epidermal growth factor receptor (EGFR). This compound is part of a broader class of tyrphostins, which are known for their ability to interfere with signal transduction pathways involved in cell proliferation and differentiation. Tyrphostin 47 exhibits characteristics such as moderate solubility in organic solvents and a relatively low molecular weight, which facilitates its use in biological assays. Its mechanism of action involves competitive inhibition, which can lead to the modulation of various cellular processes, making it a valuable tool in cancer research and therapeutic development. Additionally, studies have indicated that tyrphostin 47 may have implications in understanding the role of tyrosine phosphorylation in cellular signaling and its potential effects on tumor growth and metastasis. As with many chemical compounds, proper handling and safety measures should be observed due to its biological activity.
Formula:C10H8N2O2S
InChI:InChI=1/C10H8N2O2S/c11-5-7(10(12)15)3-6-1-2-8(13)9(14)4-6/h1-4,14-15H,12H2/b6-3-,10-7+
Synonyms:- Ag 213
- 2-(Phenylamino)-1,3-Thiazole-4-Carboxylic Acid
- (2E)-3-amino-2-[(Z)-(3-hydroxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-3-sulfanylprop-2-enenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tyrphostin 47
CAS:<p>Tyrphostin 47 inhibits the protein-tyrosine kinase activity of EGF-R.</p>Formula:C10H8N2O2SColor and Shape:SolidMolecular weight:220.25
