CAS 1184172-36-8

2,6-Difluoro-4-methoxy-3-pyridinol

Description:

2,6-Difluoro-4-methoxy-3-pyridinol is a chemical compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with fluorine atoms and at the 4 position with a methoxy group. This structure contributes to its unique chemical properties, including its potential as a pharmaceutical intermediate or active ingredient. The presence of the fluorine atoms enhances the compound's lipophilicity and may influence its biological activity, while the methoxy group can affect its solubility and reactivity. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular interactions can be influenced by hydrogen bonding due to the hydroxyl group, making it a candidate for various applications in medicinal chemistry. As with many fluorinated compounds, it may also exhibit distinct pharmacokinetic properties, which are important for drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₅F₂NO₂

InChI: InChI=1S/C6H5F2NO2/c1-11-3-2-4(7)9-6(8)5(3)10/h2,10H,1H3

InChI key: InChIKey=RDBQCSKGJYIMQZ-UHFFFAOYSA-N

SMILES: O(C)C=1C(O)=C(F)N=C(F)C1

Synonyms:

• 3-Pyridinol, 2,6-difluoro-4-methoxy-
• 2,6-Difluoro-4-methoxy-3-pyridinol
• 2,6-Difluoro-4-methoxypyridin-3-ol