CAS 1184172-54-0
:2-Fluoro-3-methoxy-5-methylpyridine
Description:
2-Fluoro-3-methoxy-5-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom, a methoxy group, and a methyl group. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it useful in various chemical applications. The methoxy group (-OCH3) is an electron-donating substituent that can affect the compound's polarity and solubility, while the methyl group (-CH3) can provide steric hindrance and influence the compound's overall stability. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, which can be explored in pharmaceutical research. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, are influenced by the arrangement and nature of its substituents, which can be critical for its application in various chemical processes and formulations.
Formula:C7H8FNO
InChI:InChI=1S/C7H8FNO/c1-5-3-6(10-2)7(8)9-4-5/h3-4H,1-2H3
InChI key:InChIKey=JQAAALSTPNFKJG-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)N=CC(C)=C1
Synonyms:- 2-Fluoro-3-methoxy-5-methylpyridine
- Pyridine, 2-fluoro-3-methoxy-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
