CymitQuimica logo

CAS 118419-90-2

:

Ethyl 6-propyl-3-pyridinecarboxylate

Description:
Ethyl 6-propyl-3-pyridinecarboxylate, identified by its CAS number 118419-90-2, is an organic compound belonging to the class of pyridinecarboxylates. It features a pyridine ring substituted with an ethyl ester group and a propyl side chain, contributing to its unique chemical properties. This compound is typically characterized by its moderate polarity due to the presence of the ester functional group, which can influence its solubility in various solvents. Ethyl 6-propyl-3-pyridinecarboxylate may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, this substance represents a versatile scaffold for further chemical modifications and research into its potential uses in various fields, including drug development and organic synthesis.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-3-5-10-7-6-9(8-12-10)11(13)14-4-2/h6-8H,3-5H2,1-2H3
InChI key:InChIKey=QEGNYEUAKQUAPM-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=CC(CCC)=NC1
Synonyms:
  • Ethyl 6-propyl-3-pyridinecarboxylate
  • 3-Pyridinecarboxylic acid, 6-propyl-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.