CymitQuimica logo

CAS 118419-98-0

:

2-Propenoic acid, 3-(5-bromo-3-pyridinyl)-, (E)-

Description:
2-Propenoic acid, 3-(5-bromo-3-pyridinyl)-, (E)-, also known by its CAS number 118419-98-0, is an organic compound characterized by its structure, which features a propenoic acid backbone with a brominated pyridine substituent. This compound typically exhibits properties associated with both carboxylic acids and alkenes, including the ability to undergo polymerization due to the presence of the double bond. The bromine atom in the pyridine ring can influence the compound's reactivity and solubility, often enhancing its electrophilic character. The (E)- configuration indicates that the substituents around the double bond are on opposite sides, which can affect the compound's physical properties and biological activity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular environment.
Formula:C8H6BrNO2
InChI:InChI=1S/C8H6BrNO2/c9-7-3-6(4-10-5-7)1-2-8(11)12/h1-5H,(H,11,12)/b2-1+
InChI key:InChIKey=PSCWUGHUOHMPAK-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C=1C=C(Br)C=NC1
Synonyms:
  • 2-Propenoic acid, 3-(5-bromo-3-pyridinyl)-, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.