CAS 1184296-71-6

4-Methyl-2-(1-piperazinyl)benzothiazole

Description:

4-Methyl-2-(1-piperazinyl)benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with a methyl group and a piperazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperazine ring, which is known for its role in pharmacology. The benzothiazole framework contributes to its stability and may influence its solubility and reactivity. The presence of the methyl group can affect the compound's electronic properties and steric hindrance, potentially impacting its interactions with biological targets. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in areas related to neuropharmacology or as a scaffold for further chemical modifications. As with many heterocycles, its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in various solvents and under different conditions would be essential for understanding its practical applications.

Formula: C₁₂H₁₅N₃S

InChI: InChI=1S/C12H15N3S/c1-9-3-2-4-10-11(9)14-12(16-10)15-7-5-13-6-8-15/h2-4,13H,5-8H2,1H3

InChI key: InChIKey=WWFCHSPLZLGSSG-UHFFFAOYSA-N

SMILES: CC1=C2N=C(SC2=CC=C1)N3CCNCC3

Synonyms:

• 4-Methyl-2-(1-piperazinyl)benzothiazole
• Benzothiazole, 4-methyl-2-(1-piperazinyl)-
• 4-Methyl-2-(piperazin-1-yl)benzothiazole