CAS 118430-75-4

3-Cycloheptyl-1-methyl-1H-pyrazol-5-amine

Description:

3-Cycloheptyl-1-methyl-1H-pyrazol-5-amine is a chemical compound characterized by its unique pyrazole structure, which features a five-membered ring containing two nitrogen atoms. The presence of a cycloheptyl group contributes to its hydrophobic characteristics, while the methyl group attached to the pyrazole ring enhances its solubility in organic solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its functional groups suggest potential reactivity, particularly in forming hydrogen bonds due to the amine group, which can participate in various chemical reactions, including nucleophilic substitutions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. As with many nitrogen-containing heterocycles, it may display diverse pharmacological properties, although specific biological activities would require further investigation. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₁H₁₉N₃

InChI: InChI=1S/C11H19N3/c1-14-11(12)8-10(13-14)9-6-4-2-3-5-7-9/h8-9H,2-7,12H2,1H3

InChI key: InChIKey=UWJAHHWNHDTWOP-UHFFFAOYSA-N

SMILES: NC1=CC(=NN1C)C2CCCCCC2

Synonyms:

• 3-Cycloheptyl-1-methyl-1H-pyrazol-5-amine
• 1H-Pyrazol-5-amine, 3-cycloheptyl-1-methyl-