CAS 118435-02-2

sinomedol N-oxide

Description:

Sinomedol N-oxide, with the CAS number 118435-02-2, is a chemical compound that belongs to the class of N-oxides, which are characterized by the presence of a nitrogen atom bonded to an oxygen atom, typically resulting in enhanced reactivity compared to their non-oxide counterparts. This compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Sinomedol N-oxide may exhibit specific biological activities, including anti-inflammatory or analgesic properties, which are often explored in drug development. Its molecular structure and functional groups contribute to its chemical behavior, influencing solubility, stability, and interaction with biological targets. As with many N-oxides, it may also participate in redox reactions, making it a subject of interest in various chemical research fields. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate potential hazards associated with its use.

Formula: C₂₄H₂₆FN₃O₃

InChI: InChI=1/C24H26FN3O3/c1-16-3-8-22-26-17(2)21(24(30)27(22)15-16)11-14-28(31)12-9-19(10-13-28)23(29)18-4-6-20(25)7-5-18/h3-8,15,19H,9-14H2,1-2H3

SMILES: Cc1ccc2nc(C)c(CCN3(=O)CCC(CC3)C(=O)c3ccc(cc3)F)c(=O)n2c1

Synonyms:

• 3-{2-[4-(4-fluorobenzoyl)-1-oxidopiperidin-1-yl]ethyl}-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one
• Sinomedol N-oxide