CAS 118441-85-3
:Licoricesaponin H2
Description:
Licoricesaponin H2, with the CAS number 118441-85-3, is a triterpenoid saponin derived from licorice root (Glycyrrhiza species). It is characterized by its complex structure, which typically includes a steroid-like backbone with sugar moieties attached, contributing to its amphiphilic nature. This compound exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Licoricesaponin H2 is known for its ability to interact with cell membranes, which may enhance its bioavailability and efficacy. Additionally, it has been studied for its role in modulating immune responses and its potential therapeutic applications in traditional medicine. Its solubility in water and organic solvents varies, reflecting its saponin nature, which can form micelles in solution. Overall, Licoricesaponin H2 represents a significant compound in the study of natural products and their applications in health and medicine.
Formula:C42H62O16
InChI:InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21-,22-,23-,24-,25-,26-,27+,28-,29-,30+,31+,34-,35+,38+,39+,40-,41+,42+/m0/s1
InChI key:InChIKey=LPLVUJXQOOQHMX-ZKXOMTPPSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O4)CC3)[H])(C(=O)C=C6[C@@]2(C)CC[C@]7(C)[C@]6(C[C@@](C(O)=O)(C)CC7)[H])[H]
Synonyms:- (3β,20α)-20-Carboxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-β-D-glucopyranosiduronic acid
- 30-Noroleanane, β-D-glucopyranosiduronic acid deriv.
- Licoricesaponin H2
- β-D-Glucopyranosiduronic acid, (3β,20α)-20-carboxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-
- Saponin H2, from licorice
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(18β,20α)-Glycyrrhizic acid
CAS:Formula:C42H62O16Purity:95%~99%Color and Shape:甘草Molecular weight:822.942Licorice-saponin H2
CAS:Licorice-saponin H2 (Licoricesaponin H2) is a natural productFormula:C42H62O16Purity:99.58% - 99.76%Color and Shape:White SolidMolecular weight:822.9321Licorice-saponin H2
CAS:Licorice-saponin H2 is a natural triterpenoid saponin, which is derived from the roots of Glycyrrhiza glabra, commonly known as licorice. This compound exhibits its mode of action through its ability to interact with biological membranes, influencing membrane permeability and possessing the capability to modulate various signaling pathways. These interactions often lead to diverse biological effects, including anti-inflammatory, antimicrobial, and antioxidant activities.Formula:C42H62O16Purity:Min. 95%Molecular weight:822.9 g/molRef: 4Z-G-045006
Discontinued product








