CAS 118460-43-8

Ethyl α,α-difluoro-β-hydroxy-2-furanpropanoate

Description:

Ethyl α,α-difluoro-β-hydroxy-2-furanpropanoate is a chemical compound characterized by its unique structure, which includes a furan ring and a propanoate moiety. This compound features two fluorine atoms attached to the alpha position of the carbon chain, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a hydroxyl group at the beta position enhances its polarity and solubility in polar solvents. Ethyl α,α-difluoro-β-hydroxy-2-furanpropanoate is typically synthesized through specific organic reactions that introduce the fluorine substituents and the furan ring. Its properties may include moderate volatility and a potential for hydrogen bonding due to the hydroxyl group, which can influence its behavior in biological systems. This compound may be of interest in the development of pharmaceuticals or agrochemicals, where fluorinated compounds often exhibit enhanced biological activity or stability. As with many fluorinated compounds, safety and handling precautions are essential due to the potential toxicity associated with fluorine-containing substances.

Formula: C₉H₁₀F₂O₄

InChI: InChI=1S/C9H10F2O4/c1-2-14-8(13)9(10,11)7(12)6-4-3-5-15-6/h3-5,7,12H,2H2,1H3

InChI key: InChIKey=RMNPGOWDCDQUSG-UHFFFAOYSA-N

SMILES: C(C(C(OCC)=O)(F)F)(O)C1=CC=CO1

Synonyms:

• 2-Furanpropanoic acid, α,α-difluoro-β-hydroxy-, ethyl ester
• Ethyl α,α-difluoro-β-hydroxy-2-furanpropanoate