CAS 118468-21-6

4-(Methylthio)benzeneethanamine

Description:

4-(Methylthio)benzeneethanamine, also known by its CAS number 118468-21-6, is an organic compound characterized by the presence of a benzene ring substituted with a methylthio group and an ethylamine side chain. This compound features a sulfur atom in the methylthio group, which contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the amine functional group suggests that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. Additionally, the methylthio group may influence the compound's electronic properties, affecting its reactivity in various chemical reactions. 4-(Methylthio)benzeneethanamine may be of interest in medicinal chemistry and materials science due to its structural features, which could impart biological activity or utility in synthesis. As with many organic compounds, safety and handling precautions should be observed, as the compound may exhibit toxicity or irritant properties. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.

Formula: C₉H₁₃NS

InChI: InChI=1S/C9H13NS/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7,10H2,1H3

InChI key: InChIKey=UMURWDSHMNEMOR-UHFFFAOYSA-N

SMILES: C(CN)C1=CC=C(SC)C=C1

Synonyms:

• 4-(Methylthio)benzeneethanamine
• 2-(4-Methylthiophenyl)ethylamine
• 2-(4-Methylsulfanylphenyl)ethylamine
• Benzeneethanamine, 4-(methylthio)-
• 2-[4-(Methylsulfanyl)phenyl]ethan-1-amine

2-[4-(Methylsulfanyl)phenyl]ethan-1-amine

Controlled Product

CAS: 118468-21-6

Versatile small molecule scaffold

Formula: C₉H₁₃NS

Purity: Min. 95%

Molecular weight: 167.27 g/mol

Ref: 3D-TEA46821