CymitQuimica logo

CAS 1184768-58-8

:

N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-(cyclopropylmethyl)acetamide

Description:
N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-(cyclopropylmethyl)acetamide is a synthetic organic compound characterized by its complex structure, which includes a benzoyl group, a chlorophenyl moiety, and a bromo substituent. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The chlorophenyl group may impart additional electronic effects, influencing the compound's reactivity and stability. The cyclopropylmethyl group contributes to the steric hindrance and may affect the compound's biological activity. This substance is of interest in medicinal chemistry, potentially serving as a lead compound for the development of pharmaceuticals. Its specific interactions with biological targets would depend on its three-dimensional conformation and the functional groups present. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C19H17BrClNO2
InChI:InChI=1S/C19H17BrClNO2/c20-11-18(23)22(12-13-6-7-13)17-9-8-15(21)10-16(17)19(24)14-4-2-1-3-5-14/h1-5,8-10,13H,6-7,11-12H2
InChI key:InChIKey=IWQYAYFBNZSQJG-UHFFFAOYSA-N
SMILES:N(CC1CC1)(C(CBr)=O)C2=C(C(=O)C3=CC=CC=C3)C=C(Cl)C=C2
Synonyms:
  • Acetamide, N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-(cyclopropylmethyl)-
  • N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-(cyclopropylmethyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.