CymitQuimica logo

CAS 118482-04-5

:

1-Cyclopropyl-2-methyl-1H-benzimidazole

Description:
1-Cyclopropyl-2-methyl-1H-benzimidazole is a chemical compound characterized by its unique bicyclic structure, which consists of a benzimidazole core fused with a cyclopropyl group and a methyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in the benzimidazole ring. It may display moderate to high lipophilicity, influencing its solubility in organic solvents and its interaction with biological membranes. The cyclopropyl group can impart strain and reactivity, potentially affecting the compound's stability and reactivity in various chemical environments. Additionally, the presence of the methyl group can influence the compound's electronic properties and steric hindrance. Such characteristics make 1-cyclopropyl-2-methyl-1H-benzimidazole of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific applications and efficacy would depend on further studies and evaluations in biological systems.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c1-8-12-10-4-2-3-5-11(10)13(8)9-6-7-9/h2-5,9H,6-7H2,1H3
InChI key:InChIKey=PVNMWWNQQNYJIY-UHFFFAOYSA-N
SMILES:CC=1N(C=2C(N1)=CC=CC2)C3CC3
Synonyms:
  • 1-Cyclopropyl-2-methyl-1H-benzo[d]imidazole
  • 1-Cyclopropyl-2-methyl-1H-benzimidazole
  • 1-Cyclopropyl-2-methyl-1H-1,3-benzodiazole
  • 1H-Benzimidazole, 1-cyclopropyl-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.