CAS 118482-25-0

1-(2-Fluoroethyl)-1H-benzimidazole-2-carboxaldehyde

Description:

1-(2-Fluoroethyl)-1H-benzimidazole-2-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a fluoroethyl group and an aldehyde functional group. The presence of the fluoroethyl moiety can impart distinct electronic and steric properties, potentially influencing the compound's reactivity and biological activity. The aldehyde group is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's solubility, stability, and interaction with biological systems would be critical factors to consider in its practical applications. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound, given the potential hazards associated with its functional groups.

Formula: C₁₀H₉FN₂O

InChI: InChI=1S/C10H9FN2O/c11-5-6-13-9-4-2-1-3-8(9)12-10(13)7-14/h1-4,7H,5-6H2

InChI key: InChIKey=DBBZGJOGVOQDKG-UHFFFAOYSA-N

SMILES: C(CF)N1C=2C(N=C1C=O)=CC=CC2

Synonyms:

• 1H-Benzimidazole-2-carboxaldehyde, 1-(2-fluoroethyl)-
• 1-(2-Fluoroethyl)-1H-benzimidazole-2-carboxaldehyde
• 1-(2-Fluoroethyl)-1H-1,3-benzodiazole-2-carbaldehyde
• 1-(2-Fluoroethyl)-1H-benzo[d]imidazole-2-carbaldehyde