
CAS 118485-49-7
:2-(4-Methyl-2-thiazolyl)phenol
Description:
2-(4-Methyl-2-thiazolyl)phenol, identified by its CAS number 118485-49-7, is an organic compound characterized by the presence of a phenolic group and a thiazole ring. This compound typically exhibits a molecular structure that includes a methyl group attached to the thiazole, contributing to its unique chemical properties. It is often recognized for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The thiazole moiety can enhance the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the hydroxyl group in the phenol structure can influence its solubility and reactivity, allowing for various chemical modifications. The compound may also exhibit antimicrobial or antifungal properties, which are common in thiazole-containing compounds. Overall, 2-(4-Methyl-2-thiazolyl)phenol is a versatile chemical with significant potential for research and application in diverse scientific domains.
Formula:C10H9NOS
InChI:InChI=1S/C10H9NOS/c1-7-6-13-10(11-7)8-4-2-3-5-9(8)12/h2-6,12H,1H3
InChI key:InChIKey=DMKFYCFFMNOORY-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1)C2=NC(C)=CS2
Synonyms:- Phenol, 2-(4-methyl-2-thiazolyl)-
- 2-(4-Methyl-1,3-thiazol-2-yl)phenol
- 2-(4-Methyl-2-thiazolyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.