CAS 118488-08-7

1-(thiophen-3-yl)ethanamine

Description:

1-(Thiophen-3-yl)ethanamine, with the CAS number 118488-08-7, is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an ethylamine side chain, indicating the presence of an amine functional group attached to the ethyl group. The thiophene moiety contributes to the compound's aromaticity and can influence its electronic properties, making it potentially useful in various applications, including pharmaceuticals and organic electronics. The presence of the amine group suggests that it may exhibit basic properties and can participate in hydrogen bonding, which can affect its solubility and reactivity. Additionally, the compound may exhibit biological activity, as many thiophene derivatives are known for their pharmacological properties. Overall, 1-(thiophen-3-yl)ethanamine is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₆H₉NS

InChI: InChI=1/C6H9NS/c1-5(7)6-2-3-8-4-6/h2-5H,7H2,1H3

SMILES: CC(c1ccsc1)N

Synonyms:

• 1-(3-Thienyl)ethanamine
• 3-Thiophenemethanamine, Alpha-Methyl-

1-(Thiophen-3-yl)ethanamine

CAS: 118488-08-7

Formula: C₆H₉NS

Purity: 96%

Color and Shape: Solid

Molecular weight: 127.2074

Ref: IN-DA008TNP

1-(Thiophen-3-yl)ethanamine

CAS: 118488-08-7

1-(Thiophen-3-yl)ethanamine

Purity: 95%

Molecular weight: 127.21g/mol

Ref: 54-OR943265

1-(3-thienyl)ethanamine

CAS: 118488-08-7

Formula: C₆H₉NS

Purity: 96%

Color and Shape: No data available.

Molecular weight: 127.21

Ref: 10-F313539