
CAS 1184914-11-1
:1-(5-Pyrimidinyl)-1H-imidazol-4-amine
Description:
1-(5-Pyrimidinyl)-1H-imidazol-4-amine, identified by its CAS number 1184914-11-1, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and an imidazole moiety. This compound typically exhibits properties associated with heterocyclic amines, such as moderate solubility in polar solvents and potential biological activity due to its ability to interact with various biological targets. The presence of both the pyrimidine and imidazole rings suggests that it may participate in hydrogen bonding and π-π stacking interactions, which are significant in biological systems. Additionally, this compound may serve as a scaffold for the development of pharmaceuticals, particularly in the fields of oncology or infectious diseases, owing to its potential to modulate enzyme activity or receptor interactions. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to further studies to explore its pharmacological properties and mechanisms of action.
Formula:C7H7N5
InChI:InChI=1S/C7H7N5/c8-7-3-12(5-11-7)6-1-9-4-10-2-6/h1-5H,8H2
InChI key:InChIKey=SLCBIDHOVZEWMJ-UHFFFAOYSA-N
SMILES:NC1=CN(C=N1)C=2C=NC=NC2
Synonyms:- 1-(5-Pyrimidinyl)-1H-imidazol-4-amine
- 1H-Imidazol-4-amine, 1-(5-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.