
CAS 1184915-94-3
:Ethyl 3-(4-chlorophenyl)-4-cyano-5-(4-morpholinyl)-2-thiophenecarboxylate
Description:
Ethyl 3-(4-chlorophenyl)-4-cyano-5-(4-morpholinyl)-2-thiophenecarboxylate is a synthetic organic compound characterized by its complex molecular structure, which includes a thiophene ring, a cyano group, and an ethyl ester functional group. The presence of the 4-chlorophenyl and 4-morpholinyl substituents contributes to its potential biological activity and solubility properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and heterocyclic components, which can influence its interaction with biological membranes. The cyano group may impart additional reactivity, making it a candidate for further chemical modifications. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical determination or literature reference for precise values. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C18H17ClN2O3S
InChI:InChI=1S/C18H17ClN2O3S/c1-2-24-18(22)16-15(12-3-5-13(19)6-4-12)14(11-20)17(25-16)21-7-9-23-10-8-21/h3-6H,2,7-10H2,1H3
InChI key:InChIKey=NQAKGVMCKYUVNV-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=C(C(OCC)=O)SC1N2CCOCC2)C3=CC=C(Cl)C=C3
Synonyms:- Ethyl 3-(4-chlorophenyl)-4-cyano-5-(4-morpholinyl)-2-thiophenecarboxylate
- 2-Thiophenecarboxylic acid, 3-(4-chlorophenyl)-4-cyano-5-(4-morpholinyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.