CAS 1184919-11-6

4-Pyrimidineethanol, 6-chloro-α-(2,4-difluorophenyl)-5-fluoro-α,β-dimethyl-, hydrochloride (1:1)

Description:

4-Pyrimidineethanol, 6-chloro-α-(2,4-difluorophenyl)-5-fluoro-α,β-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and various halogenated phenyl groups. This substance typically appears as a hydrochloride salt, indicating it is soluble in water and may exhibit different properties compared to its free base form. The presence of fluorine atoms suggests potential applications in pharmaceuticals, as fluorinated compounds often exhibit enhanced biological activity and metabolic stability. The chloro and difluorophenyl substituents may influence the compound's reactivity and interaction with biological targets. Additionally, the α,β-dimethyl substitution can affect the steric and electronic properties, potentially impacting its pharmacokinetics and pharmacodynamics. As with many compounds in medicinal chemistry, the specific characteristics such as melting point, solubility, and biological activity would require empirical data for precise evaluation. Safety data sheets and regulatory information should be consulted for handling and usage guidelines.

Formula: C₁₄H₁₂ClF₃N₂O·ClH

InChI: InChI=1S/C14H12ClF3N2O.ClH/c1-7(12-11(18)13(15)20-6-19-12)14(2,21)9-4-3-8(16)5-10(9)17;/h3-7,21H,1-2H3;1H

InChI key: InChIKey=KNFRQNVARBDXRG-UHFFFAOYSA-N

SMILES: C(C(C)C=1C(F)=C(Cl)N=CN1)(C)(O)C2=C(F)C=C(F)C=C2.Cl

Synonyms:

• 4-Pyrimidineethanol, 6-chloro-α-(2,4-difluorophenyl)-5-fluoro-α,β-dimethyl-, hydrochloride (1:1)