CAS 1184920-08-8

3,5-Dibromo-4-(trifluoromethoxy)benzenamine

Description:

3,5-Dibromo-4-(trifluoromethoxy)benzenamine is an organic compound characterized by the presence of bromine and trifluoromethoxy functional groups attached to a benzene ring. The compound features two bromine atoms located at the 3 and 5 positions of the benzene ring, which significantly influence its reactivity and physical properties. The trifluoromethoxy group, located at the 4 position, contributes to the compound's polarity and potential for hydrogen bonding, enhancing its solubility in polar solvents. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethoxy group and the electron-donating characteristics of the amine group. As a result, it may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science. Its unique structure may also make it a candidate for further research in synthetic chemistry and medicinal chemistry, particularly in the development of new compounds with specific biological activities. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₇H₄Br₂F₃NO

InChI: InChI=1S/C7H4Br2F3NO/c8-4-1-3(13)2-5(9)6(4)14-7(10,11)12/h1-2H,13H2

InChI key: InChIKey=KTJXAGCAWULBKX-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(Br)C=C(N)C=C1Br

Synonyms:

• 3,5-Dibromo-4-(trifluoromethoxy)benzenamine
• Benzenamine, 3,5-dibromo-4-(trifluoromethoxy)-