CAS 118495-07-1
:7-(BENZYLOXY)-2-NAPHTHOL
Description:
7-(Benzyloxy)-2-naphthol, with the CAS number 118495-07-1, is an organic compound characterized by its naphthalene structure substituted with a benzyloxy group at the 7-position and a hydroxyl group at the 2-position. This compound typically appears as a solid and is known for its aromatic properties due to the presence of the naphthalene ring system. The benzyloxy group enhances its lipophilicity, making it soluble in organic solvents while potentially limiting its solubility in water. 7-(Benzyloxy)-2-naphthol can exhibit various chemical reactivity, including potential hydrogen bonding due to the hydroxyl group, which may influence its interactions in biological systems or chemical reactions. It is often utilized in organic synthesis and may serve as an intermediate in the production of more complex molecules. Additionally, its structural features may confer specific biological activities, making it of interest in medicinal chemistry and research applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C17H14O2
InChI:InChI=1/C17H14O2/c18-16-8-6-14-7-9-17(11-15(14)10-16)19-12-13-4-2-1-3-5-13/h1-11,18H,12H2
Synonyms:- 7-(BENZYLOXY)-2-NAPHTHOL
- 7-(benzyloxy)naphthalen-2-ol
- 2-naphthalenol, 7-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.