CAS 1184963-68-5

2,6-Diazaspiro[3.3]heptane dihydrochloride

Description:

2,6-Diazaspiro[3.3]heptane dihydrochloride is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing two nitrogen atoms in the diaza positions. This compound is typically a white to off-white solid and is soluble in water due to the presence of hydrochloride groups, which enhance its solubility and stability in aqueous environments. The dihydrochloride form indicates that the compound has two hydrochloride ions associated with it, which can influence its reactivity and interaction with biological systems. 2,6-Diazaspiro[3.3]heptane dihydrochloride may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions. However, specific biological activities and safety profiles would require further investigation through empirical studies. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₅H₁₀N₂・2(HCl)

InChI: InChI=1S/C5H10N2.2ClH/c1-5(2-6-1)3-7-4-5;;/h6-7H,1-4H2;2*1H

SMILES: C1C2(CN1)CNC2.Cl.Cl

2,6-diazaspiro[3.3]heptane

CAS: 1184963-68-5

Formula: C₅H₁₂Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.0682

Ref: IN-DA008USX

2,6-Diazaspiro[3.3]heptane dihydrochloride

CAS: 1184963-68-5

2,6-Diazaspiro[3.3]heptane dihydrochloride

Purity: 98%

Color and Shape: White Solid

Molecular weight: 171.07g/mol

Ref: 54-OR19560

2,6-Diazaspiro[3.3]Heptane dihydrochloride

CAS: 1184963-68-5

Purity: 97%

Molecular weight: 171.0700073

Ref: 10-F722553

2,6-Diazaspiro[3.3]heptane Dihydrochloride

Controlled Product

CAS: 1184963-68-5

Formula: C₅H₁₀N₂HCl

Color and Shape: Neat

Molecular weight: 171.068

Ref: TR-D534360