CymitQuimica logo

CAS 1184963-69-6

:

O-[2-[2-(Trifluoromethyl)phenyl]ethyl]hydroxylamine

Description:
O-[2-[2-(Trifluoromethyl)phenyl]ethyl]hydroxylamine, with the CAS number 1184963-69-6, is a chemical compound characterized by its unique structure that includes a hydroxylamine functional group attached to a phenyl ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both hydroxylamines and aromatic compounds, such as potential reactivity in nucleophilic substitution reactions and the ability to form stable complexes with metal ions. The trifluoromethyl group enhances lipophilicity and may influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, hydroxylamines are known for their role in organic synthesis and as intermediates in various chemical reactions. The presence of the trifluoromethyl group can also impart unique electronic properties, affecting the compound's reactivity and stability. Overall, O-[2-[2-(Trifluoromethyl)phenyl]ethyl]hydroxylamine is a compound of interest for research in both synthetic and applied chemistry contexts.
Formula:C9H10F3NO
InChI:InChI=1S/C9H10F3NO/c10-9(11,12)8-4-2-1-3-7(8)5-6-14-13/h1-4H,5-6,13H2
InChI key:InChIKey=CUFUTXGHGVBGJO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CCON)C=CC=C1
Synonyms:
  • O-[2-[2-(Trifluoromethyl)phenyl]ethyl]hydroxylamine
  • Hydroxylamine, O-[2-[2-(trifluoromethyl)phenyl]ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.