CymitQuimica logo

CAS 118498-98-9

:

N-benzyl-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine

Description:
N-benzyl-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine is a chemical compound characterized by its complex structure, which includes a carbazole moiety fused with a tetrahydro framework. This compound features a benzyl group and a methyl substituent, contributing to its unique properties. It is typically classified as an organic amine, which implies it contains an amino group (-NH2) that can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The presence of the tetrahydro structure indicates that it is a saturated derivative, which may influence its solubility and reactivity. N-benzyl-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific interactions and potential applications would depend on further studies, including its pharmacokinetics and mechanism of action. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C20H22N2
InChI:InChI=1/C20H22N2/c1-14-10-11-18-17(12-14)16-8-5-9-19(20(16)22-18)21-13-15-6-3-2-4-7-15/h2-4,6-7,10-12,19,21-22H,5,8-9,13H2,1H3
SMILES:Cc1ccc2c(c1)c1CCCC(c1[nH]2)NCc1ccccc1
Synonyms:
  • 1H-Carbazol-1-amine, 2,3,4,9-tetrahydro-6-methyl-N-(phenylmethyl)-
  • Benzyl-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.