CymitQuimica logo

CAS 1185-11-1

:

difluoro(dinitro)methane

Description:
Difluoro(dinitro)methane, with the CAS number 1185-11-1, is a chemical compound characterized by its unique structure, which includes two fluorine atoms and two nitro groups attached to a methane backbone. This compound is typically a colorless to pale yellow liquid and is known for its high density and low volatility. It exhibits significant polarity due to the presence of electronegative fluorine and nitro groups, which can influence its reactivity and solubility in various solvents. Difluoro(dinitro)methane is primarily used in specialized applications, including as a reagent in organic synthesis and potentially in the development of energetic materials due to its nitro groups, which can impart explosive properties. Safety considerations are paramount when handling this compound, as it may pose risks such as toxicity and environmental hazards. Proper storage and handling protocols are essential to mitigate these risks, ensuring safe use in laboratory and industrial settings.
Formula:CF2N2O4
InChI:InChI=1/CF2N2O4/c2-1(3,4(6)7)5(8)9
SMILES:C(F)(F)(N(=O)=O)N(=O)=O
Synonyms:
  • Difluorodinitromethane
  • Methane, Difluorodinitro-
  • Difluoro(dinitro)methane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.