CAS 118511-98-1

6-Chloro-1H-indazole-3-propanamine

Description:

6-Chloro-1H-indazole-3-propanamine is a chemical compound characterized by its indazole core, which features a chlorine substituent at the 6-position and a propanamine group at the 3-position. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the chlorine atom can influence the compound's lipophilicity and reactivity, while the propanamine moiety may enhance its interaction with biological targets, such as receptors or enzymes. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular properties, including melting point, boiling point, and spectral characteristics, are essential for understanding its behavior in various chemical environments. Additionally, safety and handling considerations are crucial, as with many chemical substances, due to potential toxicity or reactivity. Overall, 6-Chloro-1H-indazole-3-propanamine represents a compound of interest for further research in the fields of organic synthesis and drug development.

Formula: C₁₀H₁₂ClN₃

InChI: InChI=1S/C10H12ClN3/c11-7-3-4-8-9(2-1-5-12)13-14-10(8)6-7/h3-4,6H,1-2,5,12H2,(H,13,14)

InChI key: InChIKey=HUPHSVATKIAFCA-UHFFFAOYSA-N

SMILES: C(CCN)C=1C=2C(=CC(Cl)=CC2)NN1

Synonyms:

• 1H-Indazole-3-propanamine, 6-chloro-
• 6-Chloro-1H-indazole-3-propanamine