CAS 1185121-47-4

Pyrrolidine, 3-[5-methyl-2-(1-methylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[5-methyl-2-(1-methylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a phenoxy group, specifically a 5-methyl-2-(1-methylethyl)phenoxy substituent, indicates that the compound has a complex aromatic structure that may influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its pharmacokinetic properties. The compound may exhibit various biological activities, potentially making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and the presence of the hydrochloride form may stabilize the compound for storage and use in laboratory settings. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects. Further studies would be necessary to elucidate its specific properties and applications.

Formula: C₁₄H₂₁NO·ClH

InChI: InChI=1S/C14H21NO.ClH/c1-10(2)13-5-4-11(3)8-14(13)16-12-6-7-15-9-12;/h4-5,8,10,12,15H,6-7,9H2,1-3H3;1H

InChI key: InChIKey=SQROVNHBNBXEPC-UHFFFAOYSA-N

SMILES: O(C1=C(C(C)C)C=CC(C)=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-[5-methyl-2-(1-methylethyl)phenoxy]-, hydrochloride (1:1)