CAS 1185133-69-0
:2-[(2-AZIDOETHOXY-D4)METHYL]-4-(2-CHLOROPHENYL)-3-ETHOXYCARBONYL-5-METHOXYCARBONYL)-6-METHYL-1,4-DIHYDROPYRIDINE
Description:
The chemical substance known as 2-[(2-Azidoethoxy-D4)methyl]-4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-1,4-dihydropyridine is a complex organic compound characterized by its dihydropyridine core, which is a five-membered ring containing nitrogen. This compound features multiple functional groups, including azido, ethoxycarbonyl, and methoxycarbonyl moieties, contributing to its potential reactivity and biological activity. The presence of a chlorophenyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The azido group may facilitate further chemical modifications or serve as a bioorthogonal handle in synthetic applications. The D4 designation indicates deuteration at specific positions, which can enhance the compound's stability and alter its pharmacokinetic properties. Overall, this compound's unique structure and functionalization may provide avenues for research in drug development, particularly in the context of targeting specific biological pathways or mechanisms.
Formula:C20H19ClD4N4O5
InChI:InChI=1S/C20H23ClN4O5/c1-4-30-20(27)18-15(11-29-10-9-23-25-22)24-12(2)16(19(26)28-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,24H,4,9-11H2,1-3H3/i9D2,10D2
InChI key:InChIKey=ORRUHLWSVNVRGO-YQUBHJMPSA-N
SMILES:C(OCC)(=O)C=1C(C(C(OC)=O)=C(C)NC1COC(C(N=[N+]=[N-])([2H])[2H])([2H])[2H])C2=C(Cl)C=CC=C2
Synonyms:- 2-[(2-Azidoethoxy-d4)Methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-Methyl-3,5-pyridinedicarboxylic Acid 3-Ethyl 5-Methyl Ester
- O3-Ethyl O5-methyl 2-[(2-azido-1,1,2,2-tetradeuterioethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate
- 2-[(2-AZIDOETHOXY-D4)METHYL]-4-(2-CHLOROPHENYL)-3-ETHOXYCARBONYL-5-METHOXYCARBONYL)-6-METHYL-1,4-DIHYDROPYRIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[(2-Azidoethoxy-d4)methyl]-4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl)-6-methyl-1,4-dihydropyridine
CAS:Controlled ProductFormula:C20H19D4ClN4O5Color and Shape:NeatMolecular weight:438.9
