
CAS 118524-14-4
:Licocoumarone
Description:
Licocoumarone, identified by its CAS number 118524-14-4, is a chemical compound that belongs to the class of coumarins, which are known for their aromatic properties and presence in various natural products. This substance typically exhibits a yellow to brown color and is characterized by its distinct sweet, herbaceous odor. Licocoumarone is soluble in organic solvents, which makes it useful in various applications, including as a flavoring agent and in the formulation of fragrances. Its chemical structure features a coumarin backbone, which contributes to its biological activity, including potential antimicrobial and antioxidant properties. Additionally, licocoumarone may be involved in various chemical reactions due to the presence of functional groups that can participate in electrophilic or nucleophilic interactions. As with many coumarins, it is important to handle licocoumarone with care, as some derivatives can exhibit toxicity or phototoxicity under certain conditions. Overall, licocoumarone is a compound of interest in both the chemical and pharmaceutical industries due to its diverse properties and potential applications.
Formula:C20H20O5
InChI:InChI=1S/C20H20O5/c1-11(2)4-6-14-17(23)10-19-15(20(14)24-3)9-18(25-19)13-7-5-12(21)8-16(13)22/h4-5,7-10,21-23H,6H2,1-3H3
InChI key:InChIKey=CNPMAFLUEHEXRE-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=C2)C3=C(O)C=C(O)C=C3)=CC(O)=C1CC=C(C)C
Synonyms:- 1,3-Benzenediol, 4-[6-hydroxy-4-methoxy-5-(3-methyl-2-buten-1-yl)-2-benzofuranyl]-
- 1,3-Benzenediol, 4-[6-hydroxy-4-methoxy-5-(3-methyl-2-butenyl)-2-benzofuranyl]-
- 4-[6-Hydroxy-4-methoxy-5-(3-methyl-2-buten-1-yl)-2-benzofuranyl]-1,3-benzenediol
- Licocoumarone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Licocoumarone
CAS:Licocoumarone is a useful organic compound for research related to life sciences. The catalog number is T126266 and the CAS number is 118524-14-4.Formula:C20H20O5Color and Shape:SolidMolecular weight:340.375
