CAS 1185240-24-7

Description:

The chemical substance with the CAS number 1185240-24-7 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties including molecular structure, solubility, boiling and melting points, and reactivity, which are determined by their chemical composition and functional groups. To understand its characteristics, one would typically look at its physical properties such as color, state (solid, liquid, gas), and odor, as well as its chemical properties including stability, acidity or basicity, and potential hazards. Additionally, safety data sheets (SDS) would provide crucial information regarding handling, storage, and potential health effects. For precise details, consulting specialized chemical databases or scientific literature would be necessary, as they can provide comprehensive insights into the compound's behavior and applications in various fields.

Formula: C₁₁H₉D₆N₃O₂·ClH

InChI: InChI=1S/C11H15N3O2.ClH/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3;/h4-8H,1-3H3,(H,12,15);1H/i2D3,3D3;

InChI key: InChIKey=MYPKGPZHHQEODQ-HVTBMTIBSA-N

SMILES: O(C(NC)=O)C1=CC(N=CN(C([2H])([2H])[2H])C([2H])([2H])[2H])=CC=C1.Cl

Synonyms:

• [3-[(Bis(trideuteriomethyl)amino)methylideneamino]phenyl] N-methylcarbamate hydrochloride

Formetanate-d6, Hydrochloride

Controlled Product

CAS: 1185240-24-7

Applications Formetanate-d6, Hydrochloride (cas# 1185240-24-7) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₁₂H₆H₉N₃O₂·ClH

Color and Shape: Off White Solid

Molecular weight: 263.75

Ref: TR-F692802