CymitQuimica logo

CAS 118525-49-8

:

Licoricesaponin C2

Description:
Licoricesaponin C2 is a triterpenoid saponin derived from the root of Glycyrrhiza species, commonly known as licorice. This compound is characterized by its complex structure, which typically includes a steroid-like backbone with sugar moieties attached, contributing to its amphiphilic nature. Licoricesaponin C2 exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its solubility in water and organic solvents varies, which influences its bioavailability and interaction with biological membranes. Additionally, licoricesaponins are known for their ability to form micelles and foams, which can enhance the absorption of other compounds. The compound's safety profile and therapeutic potential are subjects of ongoing studies, particularly in traditional medicine contexts. Overall, Licoricesaponin C2 represents a significant area of interest in natural product chemistry and pharmacognosy, highlighting the importance of plant-derived compounds in drug discovery and development.
Formula:C42H62O15
InChI:InChI=1S/C42H62O15/c1-37(2)21-10-13-42(7)22(9-8-19-20-18-39(4,36(52)53)15-14-38(20,3)16-17-41(19,42)6)40(21,5)12-11-23(37)54-35-31(27(46)26(45)30(56-35)33(50)51)57-34-28(47)24(43)25(44)29(55-34)32(48)49/h8-9,21-31,34-35,43-47H,10-18H2,1-7H3,(H,48,49)(H,50,51)(H,52,53)/t21-,22+,23-,24-,25-,26-,27-,28+,29-,30-,31+,34-,35+,38+,39-,40-,41+,42+/m0/s1
InChI key:InChIKey=WPDHECQXVOACTR-MOBXHYNLSA-N
SMILES:C[C@]12[C@@]3(C)C(=C4[C@@](C)(CC3)CC[C@@](C(O)=O)(C)C4)C=C[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O6)CC5)[H])[H]
Synonyms:
  • Saponin C2, from licorice
  • Licoricesaponin C2
  • β-D-Glucopyranosiduronic acid, (3β,20β)-20-carboxy-30-noroleana-11,13(18)-dien-3-yl 2-O-β-D-glucopyranuronosyl-
  • 30-Noroleanane, β-D-glucopyranosiduronic acid deriv.
  • (3β,20β)-20-Carboxy-30-noroleana-11,13(18)-dien-3-yl 2-O-β-D-glucopyranuronosyl-β-D-glucopyranosiduronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.