CAS 1185251-09-5
:3-(2-Naphthalenylamino)alanine
Description:
3-(2-Naphthalenylamino)alanine, identified by its CAS number 1185251-09-5, is an organic compound characterized by the presence of an amino acid structure combined with a naphthalene moiety. This compound features an alanine backbone, which is an α-amino acid, and a 2-naphthylamine group, contributing to its unique properties. The presence of the naphthalene ring imparts aromatic characteristics, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research and development. The amino group allows for potential interactions in biological systems, while the naphthalene component may enhance hydrophobic interactions. Additionally, the compound's structure suggests it may participate in various chemical reactions, including coupling and substitution reactions, which are common in organic synthesis. Overall, 3-(2-Naphthalenylamino)alanine represents a class of compounds that bridge the fields of organic chemistry and biochemistry, with potential applications in drug design and development.
Formula:C13H14N2O2
InChI:InChI=1S/C13H14N2O2/c14-12(13(16)17)8-15-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12,15H,8,14H2,(H,16,17)
InChI key:InChIKey=HIAVWJOQCVNAQC-UHFFFAOYSA-N
SMILES:N(CC(C(O)=O)N)C1=CC2=C(C=C1)C=CC=C2
Synonyms:- 2-Amino-3-[(naphthalen-2-yl)amino]propanoic acid
- Alanine, 3-(2-naphthalenylamino)-
- 3-(2-Naphthalenylamino)alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Naphthalenylamino)alanine
CAS:Controlled ProductFormula:C13H14N2O2Color and Shape:NeatMolecular weight:230.26
