
CAS 1185257-08-2
:Methyl 4-(acetylamino)-5-(ethylsulfonyl)-2-methoxybenzoate
Description:
Methyl 4-(acetylamino)-5-(ethylsulfonyl)-2-methoxybenzoate, identified by its CAS number 1185257-08-2, is an organic compound characterized by its complex structure, which includes a methoxy group, an acetylamino group, and an ethylsulfonyl moiety attached to a benzoate framework. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many benzoate derivatives. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of functional groups that can participate in various chemical reactions. The acetylamino group may enhance its ability to interact with biological targets, while the ethylsulfonyl group could contribute to its overall stability and solubility profile. As with many synthetic organic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity. Further studies would be necessary to fully elucidate its properties and applications in medicinal chemistry or other fields.
Formula:C13H17NO6S
InChI:InChI=1S/C13H17NO6S/c1-5-21(17,18)12-6-9(13(16)20-4)11(19-3)7-10(12)14-8(2)15/h6-7H,5H2,1-4H3,(H,14,15)
InChI key:InChIKey=NOPALXAZCYDHGO-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C1=C(NC(C)=O)C=C(OC)C(C(OC)=O)=C1
Synonyms:- Benzoic acid, 4-(acetylamino)-5-(ethylsulfonyl)-2-methoxy-, methyl ester
- Methyl 4-(acetylamino)-5-(ethylsulfonyl)-2-methoxybenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
