CAS 118527-30-3

2,6-Bis(Trifluoromethyl)Bromobenzene

Description:

2,6-Bis(trifluoromethyl)bromobenzene is an aromatic compound characterized by the presence of two trifluoromethyl groups (-CF3) and one bromine atom attached to a benzene ring. This compound features a high degree of fluorination, which imparts unique chemical properties, including increased lipophilicity and thermal stability. The trifluoromethyl groups enhance the electron-withdrawing characteristics of the molecule, making it more reactive in certain chemical reactions, particularly electrophilic substitutions. The bromine atom adds to the compound's reactivity and can serve as a leaving group in various synthetic applications. Due to its fluorinated nature, 2,6-bis(trifluoromethyl)bromobenzene is often utilized in the development of pharmaceuticals, agrochemicals, and materials science. Its physical properties, such as boiling point and solubility, are influenced by the presence of the trifluoromethyl groups, which can also affect its interactions with biological systems. Overall, this compound is of interest in both industrial and research settings due to its unique structural features and reactivity.

Formula: C₈H₃BrF₆

InChI: InChI=1/C8H3BrF6/c9-6-4(7(10,11)12)2-1-3-5(6)8(13,14)15/h1-3H

SMILES: c1cc(c(c(c1)C(F)(F)F)Br)C(F)(F)F

Synonyms:

• 2,6-Ditrifluoromethylbromobenzene
• 2-Bromo-1,3-Bis(Trifluoromethyl)Benzene
• 1-bromo-2,6-Bis(trifluoromethyl)benzene

2,6-Bis(trifluoromethyl)bromobenzene

CAS: 118527-30-3

Formula: C₈H₃BrF₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 293.0038

Ref: IN-DA00330V

1,3-Bis(trifluoromethyl)-2-bromobenzene

CAS: 118527-30-3

1,3-Bis(trifluoromethyl)-2-bromobenzene

Formula: C₈H₃BrF₆

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 293.00g/mol

Ref: 54-PC6654

2,6-Bis(trifluoromethyl)bromobenzene

CAS: 118527-30-3

Formula: C₈H₃BrF₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 293.006

Ref: 10-F007829