CAS 1185291-72-8
:Ethyl 2-[4-(methoxycarbonyl)-1-piperidinyl]-3-pyridinecarboxylate
Description:
Ethyl 2-[4-(methoxycarbonyl)-1-piperidinyl]-3-pyridinecarboxylate, identified by its CAS number 1185291-72-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the methoxycarbonyl group indicates that it has potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its molecular structure suggests that it may exhibit specific biological activities, possibly related to its interaction with various receptors or enzymes. The compound is likely to be a solid or liquid at room temperature, depending on its purity and specific formulation. As with many organic compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Proper storage conditions and safety measures should be observed to ensure stability and minimize risks associated with its use.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c1-3-21-15(19)12-5-4-8-16-13(12)17-9-6-11(7-10-17)14(18)20-2/h4-5,8,11H,3,6-7,9-10H2,1-2H3
InChI key:InChIKey=QRBWBYHUMMSSQE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N=CC=C1)N2CCC(C(OC)=O)CC2
Synonyms:- 3-Pyridinecarboxylic acid, 2-[4-(methoxycarbonyl)-1-piperidinyl]-, ethyl ester
- Ethyl 2-[4-(methoxycarbonyl)-1-piperidinyl]-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.