CymitQuimica logo

CAS 1185292-58-3

:

2-(trifluoromethyl)quinoline-4-carbohydrazide

Description:
2-(Trifluoromethyl)quinoline-4-carbohydrazide is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a trifluoromethyl group and a carbohydrazide functional group. This compound typically exhibits properties associated with both heterocyclic compounds and hydrazides, such as potential biological activity and reactivity due to the presence of the hydrazide functional group. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's pharmacokinetic properties. Additionally, quinoline derivatives are often studied for their antimicrobial, anti-inflammatory, and anticancer activities. The presence of fluorine atoms can also impart unique electronic properties, making this compound of interest in medicinal chemistry and material science. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and as a building block in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C11H8F3N3O
InChI:InChI=1S/C11H8F3N3O/c12-11(13,14)9-5-7(10(18)17-15)6-3-1-2-4-8(6)16-9/h1-5H,15H2,(H,17,18)
SMILES:c1ccc2c(c1)c(cc(C(F)(F)F)n2)C(=NN)O
Synonyms:
  • 2-(Trifluoromethyl)-4-quinolinecarbohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.