CAS 1185292-59-4
:2-(Trifluoromethyl)-4-quinolinecarboxamide
Description:
2-(Trifluoromethyl)-4-quinolinecarboxamide is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a trifluoromethyl group (-CF3) at the 2-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxamide functional group at the 4-position contributes to its polar characteristics, which can facilitate interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. Additionally, the trifluoromethyl group can enhance metabolic stability and influence the compound's solubility profile. Overall, 2-(Trifluoromethyl)-4-quinolinecarboxamide represents a unique scaffold for further exploration in chemical and pharmaceutical research.
Formula:C11H7F3N2O
InChI:InChI=1S/C11H7F3N2O/c12-11(13,14)9-5-7(10(15)17)6-3-1-2-4-8(6)16-9/h1-5H,(H2,15,17)
InChI key:InChIKey=BSKYGEFKOWTHDJ-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C2=C(N=C(C(F)(F)F)C1)C=CC=C2
Synonyms:- 4-Quinolinecarboxamide, 2-(trifluoromethyl)-
- 2-(Trifluoromethyl)-4-quinolinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.