CAS 1185292-60-7

2-(Trifluoromethyl)-4-quinolinemethanamine

Description:

2-(Trifluoromethyl)-4-quinolinemethanamine, identified by its CAS number 1185292-60-7, is a chemical compound characterized by the presence of a quinoline ring system substituted with a trifluoromethyl group and an amine functional group. The trifluoromethyl group contributes to the compound's unique electronic properties, enhancing its lipophilicity and potentially influencing its reactivity and biological activity. The quinoline moiety is known for its role in various biological applications, including as a scaffold in drug development. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in areas such as agrochemicals or pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer activities. Additionally, the presence of the amine group may facilitate interactions with biological targets, enhancing its utility in therapeutic contexts. Overall, 2-(Trifluoromethyl)-4-quinolinemethanamine represents a versatile compound with significant implications in chemical research and development.

Formula: C₁₁H₉F₃N₂

InChI: InChI=1S/C11H9F3N2/c12-11(13,14)10-5-7(6-15)8-3-1-2-4-9(8)16-10/h1-5H,6,15H2

InChI key: InChIKey=PWNGBSMTUJQKBY-UHFFFAOYSA-N

SMILES: C(N)C=1C2=C(N=C(C(F)(F)F)C1)C=CC=C2

Synonyms:

• 4-Quinolinemethanamine, 2-(trifluoromethyl)-
• 2-(Trifluoromethyl)-4-quinolinemethanamine